C43H70O5 — CID 85034197
(3-hydroxy-2-icosa-5,8,11,14-tetraenoyloxypropyl) icosa-8,11,14-trienoate (PubChem CID 85034197) has the molecular formula C43H70O5 and a molecular weight of 667.03 g/mol. Its IUPAC name is (3-hydroxy-2-icosa-5,8,11,14-tetraenoyloxypropyl) icosa-8,11,14-trienoate.
| Compound Name | (3-hydroxy-2-icosa-5,8,11,14-tetraenoyloxypropyl) icosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 85034197 |
| Molecular Formula | C43H70O5 |
| Molecular Weight | 667.03 g/mol |
| Exact Mass | 666.52 |
| IUPAC Name | (3-hydroxy-2-icosa-5,8,11,14-tetraenoyloxypropyl) icosa-8,11,14-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC(CO)COC(=O)CCCCCCC=CCC=CCC=CCCCCC |
| InChI | InChI=1S/C43H70O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(45)47-40-41(39-44)48-43(46)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,23-26,30,32,41,44H,3-10,15-16,21-22,27-29,31,33-40H2,1-2H3 |
| InChIKey | JDIBHXLLYJNLGX-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.03 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|