C13H17NO — CID 104804228
1-(3-ethyl-2-pyridinyl)hex-4-yn-1-ol (PubChem CID 104804228) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(3-ethyl-2-pyridinyl)hex-4-yn-1-ol.
| Compound Name | 1-(3-ethyl-2-pyridinyl)hex-4-yn-1-ol |
|---|---|
| PubChem CID | 104804228 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(3-ethyl-2-pyridinyl)hex-4-yn-1-ol |
| SMILES | CC#CCCC(O)c1ncccc1CC |
| InChI | InChI=1S/C13H17NO/c1-3-5-6-9-12(15)13-11(4-2)8-7-10-14-13/h7-8,10,12,15H,4,6,9H2,1-2H3 |
| InChIKey | RHRDZQPGSJYRAX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|