C15H15ClFNO — CID 114855034
2-(4-chloro-2-fluorophenyl)-1-(3-ethyl-2-pyridinyl)ethanol (PubChem CID 114855034) has the molecular formula C15H15ClFNO and a molecular weight of 279.74 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-1-(3-ethyl-2-pyridinyl)ethanol.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-1-(3-ethyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 114855034 |
| Molecular Formula | C15H15ClFNO |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-1-(3-ethyl-2-pyridinyl)ethanol |
| SMILES | CCc1cccnc1C(O)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H15ClFNO/c1-2-10-4-3-7-18-15(10)14(19)8-11-5-6-12(16)9-13(11)17/h3-7,9,14,19H,2,8H2,1H3 |
| InChIKey | FZWZUVNTSHXFAQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |