C11H12ClN3O2 — CID 106398798
1-(2-chlorophenyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)ethanol (PubChem CID 106398798) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)ethanol.
| Compound Name | 1-(2-chlorophenyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)ethanol |
|---|---|
| PubChem CID | 106398798 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 1-(2-chlorophenyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)ethanol |
| SMILES | OC(CNCc1ncon1)c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c12-9-4-2-1-3-8(9)10(16)5-13-6-11-14-7-17-15-11/h1-4,7,10,13,16H,5-6H2 |
| InChIKey | POEGRCVJRQUEAT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |