C6H5F4N3O2 — CID 106409869
2,2,3,3-tetrafluoro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (PubChem CID 106409869) has the molecular formula C6H5F4N3O2 and a molecular weight of 227.12 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106409869 |
| Molecular Formula | C6H5F4N3O2 |
| Molecular Weight | 227.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| SMILES | O=C(NCc1ncon1)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H5F4N3O2/c7-4(8)6(9,10)5(14)11-1-3-12-2-15-13-3/h2,4H,1H2,(H,11,14) |
| InChIKey | JFLXDMFMEOITHU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.12 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|