C8H13N5O3 — CID 106405904
3-amino-3-hydroxyimino-2,2-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (PubChem CID 106405904) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-2,2-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
| Compound Name | 3-amino-3-hydroxyimino-2,2-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106405904 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-amino-3-hydroxyimino-2,2-dimethyl-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| SMILES | CC(C)(C(=O)NCc1ncon1)C(N)=NO |
| InChI | InChI=1S/C8H13N5O3/c1-8(2,6(9)12-15)7(14)10-3-5-11-4-16-13-5/h4,15H,3H2,1-2H3,(H2,9,12)(H,10,14) |
| InChIKey | YHYOUUPWURXEOS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|