C12H14N4O3 — CID 106391378
3-(2-aminophenoxy)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (PubChem CID 106391378) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-(2-aminophenoxy)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
| Compound Name | 3-(2-aminophenoxy)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106391378 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-(2-aminophenoxy)-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| SMILES | Nc1ccccc1OCCC(=O)NCc1ncon1 |
| InChI | InChI=1S/C12H14N4O3/c13-9-3-1-2-4-10(9)18-6-5-12(17)14-7-11-15-8-19-16-11/h1-4,8H,5-7,13H2,(H,14,17) |
| InChIKey | KVRAVHMFEJYOAO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|