2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid

C15H16N2O4 — CID 119233717

IUPAC2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid
SMILESO=C(Cc1ccon1)NCC(Cc1ccccc1)C(=O)O
InChIInChI=1S/C15H16N2O4/c18-14(9-13-6-7-21-17-13)16-10-12(15(19)20)8-11-4-2-1-3-5-11/h1-7,12H,8-10H2,(H,16,18)(H,19,20)
InChIKeyPLCCIRJPPMGHKE-UHFFFAOYSA-N
MW288.30 g/mol
LogP1.28
Rot. Bonds7

About 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid

2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid (PubChem CID 119233717) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid.

Molecular Properties

Compound Name2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid
PubChem CID119233717
Molecular FormulaC15H16N2O4
Molecular Weight288.30 g/mol
Exact Mass288.11
IUPAC Name2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid
SMILESO=C(Cc1ccon1)NCC(Cc1ccccc1)C(=O)O
InChIInChI=1S/C15H16N2O4/c18-14(9-13-6-7-21-17-13)16-10-12(15(19)20)8-11-4-2-1-3-5-11/h1-7,12H,8-10H2,(H,16,18)(H,19,20)
InChIKeyPLCCIRJPPMGHKE-UHFFFAOYSA-N
XLogP1.28
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.30
LogP ≤ 51.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid?
The IUPAC name of 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid (CID 119233717) is 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid.
What is the SMILES notation for 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid?
The canonical SMILES for 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid is O=C(Cc1ccon1)NCC(Cc1ccccc1)C(=O)O.
What is the InChIKey of 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid?
The InChIKey is PLCCIRJPPMGHKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4/c18-14(9-13-6-7-21-17-13)16-10-12(15(19)20)8-11-4-2-1-3-5-11/h1-7,12H,8-10H2,(H,16,18)(H,19,20).
What are the key properties of 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid?
2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid has a molecular weight of 288.30 g/mol, XLogP of 1.28, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-[[2-(1,2-oxazol-3-yl)acetyl]amino]propanoic acid is sourced from PubChem (CID 119233717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).