C8H8N2O2 — CID 131134519
2-(1,2-oxazol-3-yl)-N-prop-2-ynylacetamide (PubChem CID 131134519) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-(1,2-oxazol-3-yl)-N-prop-2-ynylacetamide.
| Compound Name | 2-(1,2-oxazol-3-yl)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 131134519 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2-(1,2-oxazol-3-yl)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)Cc1ccon1 |
| InChI | InChI=1S/C8H8N2O2/c1-2-4-9-8(11)6-7-3-5-12-10-7/h1,3,5H,4,6H2,(H,9,11) |
| InChIKey | PJIIRVBMWZCWSE-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|