C13H25IN6O2 — CID 111812474
1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111812474) has the molecular formula C13H25IN6O2 and a molecular weight of 424.29 g/mol. Its IUPAC name is 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111812474 |
| Molecular Formula | C13H25IN6O2 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1C/N=C(\N)NCCN1C(=O)CNC1=O.I |
| InChI | InChI=1S/C13H24N6O2.HI/c1-2-18-6-3-4-10(18)8-16-12(14)15-5-7-19-11(20)9-17-13(19)21;/h10H,2-9H2,1H3,(H,17,21)(H3,14,15,16);1H |
| InChIKey | CBZPIEWQKJADLF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|