C13H30IN5 — CID 111085782
1-[2-[ethyl(methyl)amino]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111085782) has the molecular formula C13H30IN5 and a molecular weight of 383.32 g/mol. Its IUPAC name is 1-[2-[ethyl(methyl)amino]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[ethyl(methyl)amino]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111085782 |
| Molecular Formula | C13H30IN5 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[2-[ethyl(methyl)amino]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN(C)CCN/C(N)=N/CC1CCCN1CC.I |
| InChI | InChI=1S/C13H29N5.HI/c1-4-17(3)10-8-15-13(14)16-11-12-7-6-9-18(12)5-2;/h12H,4-11H2,1-3H3,(H3,14,15,16);1H |
| InChIKey | IWLFIGXBDQRWMZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|