C22H35IN4O3S — CID 109439142
1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide (PubChem CID 109439142) has the molecular formula C22H35IN4O3S and a molecular weight of 562.52 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109439142 |
| Molecular Formula | C22H35IN4O3S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfinylcyclohexyl)-2-[3-(3-oxo-1,4-benzoxazin-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1C(=O)COc2ccccc21)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C22H34N4O3S.HI/c1-3-23-22(25-17-9-7-10-18(15-17)30(28)4-2)24-13-8-14-26-19-11-5-6-12-20(19)29-16-21(26)27;/h5-6,11-12,17-18H,3-4,7-10,13-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | IKSVOPWGBUCFOH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|