C18H18F4IN3 — CID 111044999
1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111044999) has the molecular formula C18H18F4IN3 and a molecular weight of 479.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111044999 |
| Molecular Formula | C18H18F4IN3 |
| Molecular Weight | 479.26 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(F)cc1C(F)(F)F)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H17F4N3.HI/c19-14-6-4-13(16(9-14)18(20,21)22)10-24-17(23)25-15-7-5-11-2-1-3-12(11)8-15;/h4-9H,1-3,10H2,(H3,23,24,25);1H |
| InChIKey | XKXXQJMTUICQMZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|