C23H26FIN4O3 — CID 111051379
1-(2,5-diethoxyphenyl)-2-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111051379) has the molecular formula C23H26FIN4O3 and a molecular weight of 552.39 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111051379 |
| Molecular Formula | C23H26FIN4O3 |
| Molecular Weight | 552.39 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/Cc2ccc(Oc3ccc(F)cc3)nc2)c1.I |
| InChI | InChI=1S/C23H25FN4O3.HI/c1-3-29-19-10-11-21(30-4-2)20(13-19)28-23(25)27-15-16-5-12-22(26-14-16)31-18-8-6-17(24)7-9-18;/h5-14H,3-4,15H2,1-2H3,(H3,25,27,28);1H |
| InChIKey | CBTCYHXUGHKACB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|