C22H28N4O3 — CID 111036766
1-(2,5-dimethoxyphenyl)-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine (PubChem CID 111036766) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111036766 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2ccc(C(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-28-18-10-11-20(29-2)19(14-18)25-22(23)24-15-16-6-8-17(9-7-16)21(27)26-12-4-3-5-13-26/h6-11,14H,3-5,12-13,15H2,1-2H3,(H3,23,24,25) |
| InChIKey | ITQDUEPEOVYVJW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|