C16H23N3O2 — CID 122096895
2-(cyclohexen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine (PubChem CID 122096895) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-(cyclohexen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine.
| Compound Name | 2-(cyclohexen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 122096895 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-(cyclohexen-1-ylmethyl)-1-(2,5-dimethoxyphenyl)guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CC2=CCCCC2)c1 |
| InChI | InChI=1S/C16H23N3O2/c1-20-13-8-9-15(21-2)14(10-13)19-16(17)18-11-12-6-4-3-5-7-12/h6,8-10H,3-5,7,11H2,1-2H3,(H3,17,18,19) |
| InChIKey | QRGXQGVAYRDKBP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|