C17H23N5O2 — CID 119121281
1-(2,5-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine (PubChem CID 119121281) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119121281 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2cn3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C17H23N5O2/c1-23-13-6-7-15(24-2)14(9-13)21-17(18)19-10-12-11-22-8-4-3-5-16(22)20-12/h6-7,9,11H,3-5,8,10H2,1-2H3,(H3,18,19,21) |
| InChIKey | VPXPXQRFTTZVDE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|