C17H24IN5 — CID 119121272
1-(4-ethylphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 119121272) has the molecular formula C17H24IN5 and a molecular weight of 425.32 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(4-ethylphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119121272 |
| Molecular Formula | C17H24IN5 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1ccc(N/C(N)=N/Cc2cn3c(n2)CCCC3)cc1.I |
| InChI | InChI=1S/C17H23N5.HI/c1-2-13-6-8-14(9-7-13)21-17(18)19-11-15-12-22-10-4-3-5-16(22)20-15;/h6-9,12H,2-5,10-11H2,1H3,(H3,18,19,21);1H |
| InChIKey | NOXZLOHTLALXPH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|