C12H22IN5O — CID 119121242
1-(2-methoxyethyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 119121242) has the molecular formula C12H22IN5O and a molecular weight of 379.25 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119121242 |
| Molecular Formula | C12H22IN5O |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-(2-methoxyethyl)-2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | COCCN/C(N)=N/Cc1cn2c(n1)CCCC2.I |
| InChI | InChI=1S/C12H21N5O.HI/c1-18-7-5-14-12(13)15-8-10-9-17-6-3-2-4-11(17)16-10;/h9H,2-8H2,1H3,(H3,13,14,15);1H |
| InChIKey | SWOLSEMLLMQIDB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|