C14H24IN5 — CID 119116272
2-methyl-1-prop-2-enyl-3-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 119116272) has the molecular formula C14H24IN5 and a molecular weight of 389.29 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-3-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-prop-2-enyl-3-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119116272 |
| Molecular Formula | C14H24IN5 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-3-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCc1cn2c(n1)CCCC2.I |
| InChI | InChI=1S/C14H23N5.HI/c1-3-8-16-14(15-2)17-9-7-12-11-19-10-5-4-6-13(19)18-12;/h3,11H,1,4-10H2,2H3,(H2,15,16,17);1H |
| InChIKey | VXBGJCISUNIOGD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|