C20H25N5O — CID 119141082
2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine (PubChem CID 119141082) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119141082 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1cn2c(n1)CCCC2)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C20H25N5O/c1-14-16-7-3-4-8-17(16)26-18(14)12-23-20(21-2)22-11-15-13-25-10-6-5-9-19(25)24-15/h3-4,7-8,13H,5-6,9-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | UIZQKIFPJGCUBL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|