C20H22N4O2 — CID 111602497
4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111602497) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111602497 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)cc1)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C20H22N4O2/c1-13-16-5-3-4-6-17(16)26-18(13)12-24-20(22-2)23-11-14-7-9-15(10-8-14)19(21)25/h3-10H,11-12H2,1-2H3,(H2,21,25)(H2,22,23,24) |
| InChIKey | MEIOCIBODOYMHB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|