C23H28N4O2 — CID 111602493
2-methyl-N-[4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]propanamide (PubChem CID 111602493) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-methyl-N-[4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 111602493 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-methyl-N-[4-[[[N'-methyl-N-[(3-methyl-1-benzofuran-2-yl)methyl]carbamimidoyl]amino]methyl]phenyl]propanamide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)C(C)C)cc1)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C23H28N4O2/c1-15(2)22(28)27-18-11-9-17(10-12-18)13-25-23(24-4)26-14-21-16(3)19-7-5-6-8-20(19)29-21/h5-12,15H,13-14H2,1-4H3,(H,27,28)(H2,24,25,26) |
| InChIKey | AJDJOPUWGAFBPU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|