C16H22ClN5OS — CID 119142198
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine (PubChem CID 119142198) has the molecular formula C16H22ClN5OS and a molecular weight of 367.91 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119142198 |
| Molecular Formula | C16H22ClN5OS |
| Molecular Weight | 367.91 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1cn2c(n1)CCCC2)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H22ClN5OS/c1-18-16(20-9-12(23)13-5-6-14(17)24-13)19-8-11-10-22-7-3-2-4-15(22)21-11/h5-6,10,12,23H,2-4,7-9H2,1H3,(H2,18,19,20) |
| InChIKey | WAXKMVYSAOGWFO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.91 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|