C19H25IN4OS — CID 111603454
1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111603454) has the molecular formula C19H25IN4OS and a molecular weight of 484.41 g/mol. Its IUPAC name is 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111603454 |
| Molecular Formula | C19H25IN4OS |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 1-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N\C)NCc2oc3ccccc3c2C)cs1.I |
| InChI | InChI=1S/C19H24N4OS.HI/c1-4-18-23-14(12-25-18)9-10-21-19(20-3)22-11-17-13(2)15-7-5-6-8-16(15)24-17;/h5-8,12H,4,9-11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | MJOSHVMSCTXXAL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|