C20H27IN4O3 — CID 111049963
2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111049963) has the molecular formula C20H27IN4O3 and a molecular weight of 498.37 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111049963 |
| Molecular Formula | C20H27IN4O3 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(2,5-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2ccnc(OC3CCCC3)c2)c1.I |
| InChI | InChI=1S/C20H26N4O3.HI/c1-25-16-7-8-18(26-2)17(12-16)24-20(21)23-13-14-9-10-22-19(11-14)27-15-5-3-4-6-15;/h7-12,15H,3-6,13H2,1-2H3,(H3,21,23,24);1H |
| InChIKey | TWJOLSYXRYCCCF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|