C16H26N4O2 — CID 111049994
2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(1-methoxypropan-2-yl)guanidine (PubChem CID 111049994) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 111049994 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-[(2-cyclopentyloxy-4-pyridinyl)methyl]-1-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)N/C(N)=N/Cc1ccnc(OC2CCCC2)c1 |
| InChI | InChI=1S/C16H26N4O2/c1-12(11-21-2)20-16(17)19-10-13-7-8-18-15(9-13)22-14-5-3-4-6-14/h7-9,12,14H,3-6,10-11H2,1-2H3,(H3,17,19,20) |
| InChIKey | GHVNKWYQEVCOHB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|