C17H20F3IN4O3 — CID 111050209
1-(2,5-dimethoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111050209) has the molecular formula C17H20F3IN4O3 and a molecular weight of 512.27 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111050209 |
| Molecular Formula | C17H20F3IN4O3 |
| Molecular Weight | 512.27 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/Cc2ccnc(OCC(F)(F)F)c2)c1.I |
| InChI | InChI=1S/C17H19F3N4O3.HI/c1-25-12-3-4-14(26-2)13(8-12)24-16(21)23-9-11-5-6-22-15(7-11)27-10-17(18,19)20;/h3-8H,9-10H2,1-2H3,(H3,21,23,24);1H |
| InChIKey | SFDPSLNPVMNQBH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|