C19H19IN4O — CID 111597441
1-(3-phenoxyphenyl)-2-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111597441) has the molecular formula C19H19IN4O and a molecular weight of 446.29 g/mol. Its IUPAC name is 1-(3-phenoxyphenyl)-2-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-phenoxyphenyl)-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111597441 |
| Molecular Formula | C19H19IN4O |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 1-(3-phenoxyphenyl)-2-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccn1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H18N4O.HI/c20-19(22-14-16-7-4-5-12-21-16)23-15-8-6-11-18(13-15)24-17-9-2-1-3-10-17;/h1-13H,14H2,(H3,20,22,23);1H |
| InChIKey | VTNSHLVEXGYHDL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|