C18H18IN3OS — CID 111598509
1-(3-phenoxyphenyl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111598509) has the molecular formula C18H18IN3OS and a molecular weight of 451.33 g/mol. Its IUPAC name is 1-(3-phenoxyphenyl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-phenoxyphenyl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598509 |
| Molecular Formula | C18H18IN3OS |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 1-(3-phenoxyphenyl)-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccsc1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C18H17N3OS.HI/c19-18(20-12-14-9-10-23-13-14)21-15-5-4-8-17(11-15)22-16-6-2-1-3-7-16;/h1-11,13H,12H2,(H3,19,20,21);1H |
| InChIKey | QLQVWDWVEDLAFA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|