C22H26IN5O — CID 111600133
1-(3-phenoxyphenyl)-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 111600133) has the molecular formula C22H26IN5O and a molecular weight of 503.39 g/mol. Its IUPAC name is 1-(3-phenoxyphenyl)-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-(3-phenoxyphenyl)-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111600133 |
| Molecular Formula | C22H26IN5O |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 1-(3-phenoxyphenyl)-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCCCNc1ccccn1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H25N5O.HI/c23-22(26-16-7-6-15-25-21-13-4-5-14-24-21)27-18-9-8-12-20(17-18)28-19-10-2-1-3-11-19;/h1-5,8-14,17H,6-7,15-16H2,(H,24,25)(H3,23,26,27);1H |
| InChIKey | ZKUWDGYNSLPMJT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|