C21H24IN5O — CID 109394682
2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide (PubChem CID 109394682) has the molecular formula C21H24IN5O and a molecular weight of 489.36 g/mol. Its IUPAC name is 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109394682 |
| Molecular Formula | C21H24IN5O |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide |
| SMILES | CN(C)c1cccc(C/N=C(\N)Nc2cccc(Oc3ccccc3)c2)n1.I |
| InChI | InChI=1S/C21H23N5O.HI/c1-26(2)20-13-7-9-17(24-20)15-23-21(22)25-16-8-6-12-19(14-16)27-18-10-4-3-5-11-18;/h3-14H,15H2,1-2H3,(H3,22,23,25);1H |
| InChIKey | ABCPFJSLMRDJOM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|