C24H25IN4O3 — CID 110018014
methyl 6-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate;hydroiodide (PubChem CID 110018014) has the molecular formula C24H25IN4O3 and a molecular weight of 544.39 g/mol. Its IUPAC name is methyl 6-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate;hydroiodide.
| Compound Name | methyl 6-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110018014 |
| Molecular Formula | C24H25IN4O3 |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | methyl 6-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]-2-cyclopropylpyridine-3-carboxylate;hydroiodide |
| SMILES | COC(=O)c1ccc(C/N=C(\N)Nc2cccc(Oc3ccccc3)c2)nc1C1CC1.I |
| InChI | InChI=1S/C24H24N4O3.HI/c1-30-23(29)21-13-12-18(27-22(21)16-10-11-16)15-26-24(25)28-17-6-5-9-20(14-17)31-19-7-3-2-4-8-19;/h2-9,12-14,16H,10-11,15H2,1H3,(H3,25,26,28);1H |
| InChIKey | LJLHWBUIHAQQQV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|