C24H28IN5O2 — CID 111599087
1-[4-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 111599087) has the molecular formula C24H28IN5O2 and a molecular weight of 545.43 g/mol. Its IUPAC name is 1-[4-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 111599087 |
| Molecular Formula | C24H28IN5O2 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-[4-[[[amino-(3-phenoxyanilino)methylidene]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | CC(C)NC(=O)Nc1ccc(C/N=C(\N)Nc2cccc(Oc3ccccc3)c2)cc1.I |
| InChI | InChI=1S/C24H27N5O2.HI/c1-17(2)27-24(30)29-19-13-11-18(12-14-19)16-26-23(25)28-20-7-6-10-22(15-20)31-21-8-4-3-5-9-21;/h3-15,17H,16H2,1-2H3,(H3,25,26,28)(H2,27,29,30);1H |
| InChIKey | YHTQNSZPMBEQCY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|