C18H24N4S — CID 111817264
N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-N-phenylpiperidine-1-carboximidamide (PubChem CID 111817264) has the molecular formula C18H24N4S and a molecular weight of 328.49 g/mol. Its IUPAC name is N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-N-phenylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-N-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111817264 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N'-[2-(5-methyl-1,3-thiazol-2-yl)ethyl]-N-phenylpiperidine-1-carboximidamide |
| SMILES | Cc1cnc(CC/N=C(/Nc2ccccc2)N2CCCCC2)s1 |
| InChI | InChI=1S/C18H24N4S/c1-15-14-20-17(23-15)10-11-19-18(22-12-6-3-7-13-22)21-16-8-4-2-5-9-16/h2,4-5,8-9,14H,3,6-7,10-13H2,1H3,(H,19,21) |
| InChIKey | DFLHQNIMWINQCW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|