C19H27IN4OS — CID 119152005
N'-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 119152005) has the molecular formula C19H27IN4OS and a molecular weight of 486.42 g/mol. Its IUPAC name is N'-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119152005 |
| Molecular Formula | C19H27IN4OS |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N'-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N-phenylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | COC(C)c1nc(C/N=C(/Nc2ccccc2)N2CCCCC2)cs1.I |
| InChI | InChI=1S/C19H26N4OS.HI/c1-15(24-2)18-21-17(14-25-18)13-20-19(23-11-7-4-8-12-23)22-16-9-5-3-6-10-16;/h3,5-6,9-10,14-15H,4,7-8,11-13H2,1-2H3,(H,20,22);1H |
| InChIKey | GCDCUTOVGPECBI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|