C18H25N5 — CID 120913464
N'-[(2,5-dimethylpyrazol-3-yl)methyl]-N-phenylpiperidine-1-carboximidamide (PubChem CID 120913464) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is N'-[(2,5-dimethylpyrazol-3-yl)methyl]-N-phenylpiperidine-1-carboximidamide.
| Compound Name | N'-[(2,5-dimethylpyrazol-3-yl)methyl]-N-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 120913464 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N'-[(2,5-dimethylpyrazol-3-yl)methyl]-N-phenylpiperidine-1-carboximidamide |
| SMILES | Cc1cc(C/N=C(/Nc2ccccc2)N2CCCCC2)n(C)n1 |
| InChI | InChI=1S/C18H25N5/c1-15-13-17(22(2)21-15)14-19-18(23-11-7-4-8-12-23)20-16-9-5-3-6-10-16/h3,5-6,9-10,13H,4,7-8,11-12,14H2,1-2H3,(H,19,20) |
| InChIKey | MRWIMADCZWHECM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|