C20H26N4O2S — CID 111046434
N'-[[4-(methylsulfamoyl)phenyl]methyl]-N-phenylpiperidine-1-carboximidamide (PubChem CID 111046434) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N'-[[4-(methylsulfamoyl)phenyl]methyl]-N-phenylpiperidine-1-carboximidamide.
| Compound Name | N'-[[4-(methylsulfamoyl)phenyl]methyl]-N-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111046434 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N'-[[4-(methylsulfamoyl)phenyl]methyl]-N-phenylpiperidine-1-carboximidamide |
| SMILES | CNS(=O)(=O)c1ccc(C/N=C(\Nc2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H26N4O2S/c1-21-27(25,26)19-12-10-17(11-13-19)16-22-20(24-14-6-3-7-15-24)23-18-8-4-2-5-9-18/h2,4-5,8-13,21H,3,6-7,14-16H2,1H3,(H,22,23) |
| InChIKey | BKRWYCNYRILVNU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|