C18H20ClN3 — CID 101489117
N'-benzyl-N-(2-chlorophenyl)pyrrolidine-1-carboximidamide (PubChem CID 101489117) has the molecular formula C18H20ClN3 and a molecular weight of 313.83 g/mol. Its IUPAC name is N'-benzyl-N-(2-chlorophenyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-benzyl-N-(2-chlorophenyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 101489117 |
| Molecular Formula | C18H20ClN3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N'-benzyl-N-(2-chlorophenyl)pyrrolidine-1-carboximidamide |
| SMILES | Clc1ccccc1N/C(=N/Cc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C18H20ClN3/c19-16-10-4-5-11-17(16)21-18(22-12-6-7-13-22)20-14-15-8-2-1-3-9-15/h1-5,8-11H,6-7,12-14H2,(H,20,21) |
| InChIKey | QDPBIIXPHXRTLU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|