C14H20ClN3 — CID 110955946
N'-[(2-chlorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 110955946) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is N'-[(2-chlorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[(2-chlorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110955946 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N'-[(2-chlorophenyl)methyl]-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C14H20ClN3/c1-2-16-14(18-9-5-6-10-18)17-11-12-7-3-4-8-13(12)15/h3-4,7-8H,2,5-6,9-11H2,1H3,(H,16,17) |
| InChIKey | OOTBPRKDSIAGID-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|