C19H31N5O — CID 109453216
3-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide (PubChem CID 109453216) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 109453216 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 3-[[ethylamino-(2,2,3,3-tetramethylazetidin-1-yl)methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cn1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C19H31N5O/c1-7-20-17(24-13-18(3,4)19(24,5)6)21-11-10-16(25)23-15-9-8-14(2)12-22-15/h8-9,12H,7,10-11,13H2,1-6H3,(H,20,21)(H,22,23,25) |
| InChIKey | CEDXXAISWYLPMJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|