C20H34IN5O3 — CID 111748218
3-[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide (PubChem CID 111748218) has the molecular formula C20H34IN5O3 and a molecular weight of 519.43 g/mol. Its IUPAC name is 3-[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111748218 |
| Molecular Formula | C20H34IN5O3 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 3-[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]-N-(5-methyl-2-pyridinyl)propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cn1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C20H33N5O3.HI/c1-4-21-20(25-10-8-17(14-25)15-28-12-11-27-3)22-9-7-19(26)24-18-6-5-16(2)13-23-18;/h5-6,13,17H,4,7-12,14-15H2,1-3H3,(H,21,22)(H,23,24,26);1H |
| InChIKey | XYDYNIYQCBWISF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|