C20H39IN4O2 — CID 111212044
tert-butyl 4-[[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111212044) has the molecular formula C20H39IN4O2 and a molecular weight of 494.46 g/mol. Its IUPAC name is tert-butyl 4-[[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111212044 |
| Molecular Formula | C20H39IN4O2 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | tert-butyl 4-[[[ethylamino-(4-methylpiperidin-1-yl)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(C(=O)OC(C)(C)C)CC1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C20H38N4O2.HI/c1-6-21-18(23-11-7-16(2)8-12-23)22-15-17-9-13-24(14-10-17)19(25)26-20(3,4)5;/h16-17H,6-15H2,1-5H3,(H,21,22);1H |
| InChIKey | LAVHBXLDCOKSKZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|