C22H41IN4O4 — CID 110993252
tert-butyl 3-[[[(3-ethoxycarbonylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 110993252) has the molecular formula C22H41IN4O4 and a molecular weight of 552.50 g/mol. Its IUPAC name is tert-butyl 3-[[[(3-ethoxycarbonylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[[(3-ethoxycarbonylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993252 |
| Molecular Formula | C22H41IN4O4 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | tert-butyl 3-[[[(3-ethoxycarbonylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN(C(=O)OC(C)(C)C)C1)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C22H40N4O4.HI/c1-6-23-20(25-12-9-11-18(16-25)19(27)29-7-2)24-14-17-10-8-13-26(15-17)21(28)30-22(3,4)5;/h17-18H,6-16H2,1-5H3,(H,23,24);1H |
| InChIKey | VKIVCCAXSKPZAS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|