C21H40N4O3 — CID 111391813
tert-butyl 4-[[[[3-(cyclopropylmethoxy)propylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate (PubChem CID 111391813) has the molecular formula C21H40N4O3 and a molecular weight of 396.58 g/mol. Its IUPAC name is tert-butyl 4-[[[[3-(cyclopropylmethoxy)propylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[[3-(cyclopropylmethoxy)propylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111391813 |
| Molecular Formula | C21H40N4O3 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | tert-butyl 4-[[[[3-(cyclopropylmethoxy)propylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC1CCN(C(=O)OC(C)(C)C)CC1)NCCCOCC1CC1 |
| InChI | InChI=1S/C21H40N4O3/c1-5-22-19(23-11-6-14-27-16-18-7-8-18)24-15-17-9-12-25(13-10-17)20(26)28-21(2,3)4/h17-18H,5-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | ADIDOCSBGRSMMQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|