C24H40N4O4 — CID 111215159
tert-butyl 4-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate (PubChem CID 111215159) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is tert-butyl 4-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111215159 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | tert-butyl 4-[[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC1CCN(C(=O)OC(C)(C)C)CC1)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H40N4O4/c1-7-25-22(26-13-10-18-8-9-20(30-5)21(16-18)31-6)27-17-19-11-14-28(15-12-19)23(29)32-24(2,3)4/h8-9,16,19H,7,10-15,17H2,1-6H3,(H2,25,26,27) |
| InChIKey | FAYOPMMPCRMOIW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|