C22H43IN4O4 — CID 111748244
tert-butyl 2-[[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111748244) has the molecular formula C22H43IN4O4 and a molecular weight of 554.51 g/mol. Its IUPAC name is tert-butyl 2-[[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 2-[[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111748244 |
| Molecular Formula | C22H43IN4O4 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | tert-butyl 2-[[[ethylamino-[3-(2-methoxyethoxymethyl)pyrrolidin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCCN1C(=O)OC(C)(C)C)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C22H42N4O4.HI/c1-6-23-20(25-12-10-18(16-25)17-29-14-13-28-5)24-15-19-9-7-8-11-26(19)21(27)30-22(2,3)4;/h18-19H,6-17H2,1-5H3,(H,23,24);1H |
| InChIKey | UAPWBEQPISWBSO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|