C21H34FN3O2 — CID 111745701
N-ethyl-N'-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111745701) has the molecular formula C21H34FN3O2 and a molecular weight of 379.52 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111745701 |
| Molecular Formula | C21H34FN3O2 |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | N-ethyl-N'-[2-(4-fluorophenyl)-2-methylpropyl]-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(F)cc1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C21H34FN3O2/c1-5-23-20(25-11-10-17(14-25)15-27-13-12-26-4)24-16-21(2,3)18-6-8-19(22)9-7-18/h6-9,17H,5,10-16H2,1-4H3,(H,23,24) |
| InChIKey | MICLCLHOYMEKBK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|