C15H22FN3 — CID 111212095
N-[(2-fluorophenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide (PubChem CID 111212095) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111212095 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N',4-dimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccccc1F)N1CCC(C)CC1 |
| InChI | InChI=1S/C15H22FN3/c1-12-7-9-19(10-8-12)15(17-2)18-11-13-5-3-4-6-14(13)16/h3-6,12H,7-11H2,1-2H3,(H,17,18) |
| InChIKey | UMQJQAPYOFOPEK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|