C20H30N6 — CID 111742267
N-[2-(dimethylamino)-2-phenylethyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111742267) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742267 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(c1ccccc1)N(C)C)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C20H30N6/c1-21-20(22-13-19(24(2)3)16-8-6-5-7-9-16)26-11-10-17(15-26)18-12-23-25(4)14-18/h5-9,12,14,17,19H,10-11,13,15H2,1-4H3,(H,21,22) |
| InChIKey | IMZFORUQRVUVMA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|